C19H21FN4O — CID 3596340
3-[[2-(4-fluorophenyl)-5,6,7,8-tetrahydropyrazolo[5,1-b]quinazolin-9-yl]amino]propan-1-ol (PubChem CID 3596340) has the molecular formula C19H21FN4O and a molecular weight of 340.40 g/mol. Its IUPAC name is 3-[[2-(4-fluorophenyl)-5,6,7,8-tetrahydropyrazolo[5,1-b]quinazolin-9-yl]amino]propan-1-ol.
| Compound Name | 3-[[2-(4-fluorophenyl)-5,6,7,8-tetrahydropyrazolo[5,1-b]quinazolin-9-yl]amino]propan-1-ol |
|---|---|
| PubChem CID | 3596340 |
| Molecular Formula | C19H21FN4O |
| Molecular Weight | 340.40 g/mol |
| Exact Mass | 340.17 |
| IUPAC Name | 3-[[2-(4-fluorophenyl)-5,6,7,8-tetrahydropyrazolo[5,1-b]quinazolin-9-yl]amino]propan-1-ol |
| SMILES | OCCCNc1c2c(nc3cc(-c4ccc(F)cc4)nn13)CCCC2 |
| InChI | InChI=1S/C19H21FN4O/c20-14-8-6-13(7-9-14)17-12-18-22-16-5-2-1-4-15(16)19(24(18)23-17)21-10-3-11-25/h6-9,12,21,25H,1-5,10-11H2 |
| InChIKey | SOTSLWIROVRBAO-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 62.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.40 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|