C21H31NO5 — CID 35963987
[2-(3-methylbutylamino)-2-oxoethyl] (E)-3-(3-ethoxy-4-propoxyphenyl)prop-2-enoate (PubChem CID 35963987) has the molecular formula C21H31NO5 and a molecular weight of 377.48 g/mol. Its IUPAC name is [2-(3-methylbutylamino)-2-oxoethyl] (E)-3-(3-ethoxy-4-propoxyphenyl)prop-2-enoate.
| Compound Name | [2-(3-methylbutylamino)-2-oxoethyl] (E)-3-(3-ethoxy-4-propoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 35963987 |
| Molecular Formula | C21H31NO5 |
| Molecular Weight | 377.48 g/mol |
| Exact Mass | 377.22 |
| IUPAC Name | [2-(3-methylbutylamino)-2-oxoethyl] (E)-3-(3-ethoxy-4-propoxyphenyl)prop-2-enoate |
| SMILES | CCCOc1ccc(/C=C/C(=O)OCC(=O)NCCC(C)C)cc1OCC |
| InChI | InChI=1S/C21H31NO5/c1-5-13-26-18-9-7-17(14-19(18)25-6-2)8-10-21(24)27-15-20(23)22-12-11-16(3)4/h7-10,14,16H,5-6,11-13,15H2,1-4H3,(H,22,23)/b10-8+ |
| InChIKey | DQRYIOFOJGGLIH-CSKARUKUSA-N |
| XLogP | 3.59 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.48 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|