About N-benzyl-3-(2-oxo-3,4-dihydro-1H-quinolin-4-yl)propanamide
N-benzyl-3-(2-oxo-3,4-dihydro-1H-quinolin-4-yl)propanamide (PubChem CID 3596631) has the molecular formula C19H20N2O2
and a molecular weight of 308.38 g/mol. Its IUPAC name is N-benzyl-3-(2-oxo-3,4-dihydro-1H-quinolin-4-yl)propanamide.
Molecular Properties
| Compound Name | N-benzyl-3-(2-oxo-3,4-dihydro-1H-quinolin-4-yl)propanamide |
| PubChem CID | 3596631 |
| Molecular Formula | C19H20N2O2 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | N-benzyl-3-(2-oxo-3,4-dihydro-1H-quinolin-4-yl)propanamide |
| SMILES | O=C(CCC1CC(=O)Nc2ccccc21)NCc1ccccc1 |
| InChI | InChI=1S/C19H20N2O2/c22-18(20-13-14-6-2-1-3-7-14)11-10-15-12-19(23)21-17-9-5-4-8-16(15)17/h1-9,15H,10-13H2,(H,20,22)(H,21,23) |
| InChIKey | KAPMGKBCDUYLFE-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-benzyl-3-(2-oxo-3,4-dihydro-1H-quinolin-4-yl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-3-(2-oxo-3,4-dihydro-1H-quinolin-4-yl)propanamide?
The IUPAC name of N-benzyl-3-(2-oxo-3,4-dihydro-1H-quinolin-4-yl)propanamide (CID 3596631) is N-benzyl-3-(2-oxo-3,4-dihydro-1H-quinolin-4-yl)propanamide.
What is the SMILES notation for N-benzyl-3-(2-oxo-3,4-dihydro-1H-quinolin-4-yl)propanamide?
The canonical SMILES for N-benzyl-3-(2-oxo-3,4-dihydro-1H-quinolin-4-yl)propanamide is O=C(CCC1CC(=O)Nc2ccccc21)NCc1ccccc1.
What is the InChIKey of N-benzyl-3-(2-oxo-3,4-dihydro-1H-quinolin-4-yl)propanamide?
The InChIKey is KAPMGKBCDUYLFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20N2O2/c22-18(20-13-14-6-2-1-3-7-14)11-10-15-12-19(23)21-17-9-5-4-8-16(15)17/h1-9,15H,10-13H2,(H,20,22)(H,21,23).
What are the key properties of N-benzyl-3-(2-oxo-3,4-dihydro-1H-quinolin-4-yl)propanamide?
N-benzyl-3-(2-oxo-3,4-dihydro-1H-quinolin-4-yl)propanamide has a molecular weight of 308.38 g/mol, XLogP of 3.21, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-3-(2-oxo-3,4-dihydro-1H-quinolin-4-yl)propanamide is sourced from PubChem (CID 3596631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).