C24H24O7 — CID 3596726
(3-acetyloxy-3,6,9-trimethyl-2,7-dioxo-4,5,9a,9b-tetrahydro-3aH-azuleno[4,5-b]furan-4-yl) benzoate (PubChem CID 3596726) has the molecular formula C24H24O7 and a molecular weight of 424.45 g/mol. Its IUPAC name is (3-acetyloxy-3,6,9-trimethyl-2,7-dioxo-4,5,9a,9b-tetrahydro-3aH-azuleno[4,5-b]furan-4-yl) benzoate.
| Compound Name | (3-acetyloxy-3,6,9-trimethyl-2,7-dioxo-4,5,9a,9b-tetrahydro-3aH-azuleno[4,5-b]furan-4-yl) benzoate |
|---|---|
| PubChem CID | 3596726 |
| Molecular Formula | C24H24O7 |
| Molecular Weight | 424.45 g/mol |
| Exact Mass | 424.15 |
| IUPAC Name | (3-acetyloxy-3,6,9-trimethyl-2,7-dioxo-4,5,9a,9b-tetrahydro-3aH-azuleno[4,5-b]furan-4-yl) benzoate |
| SMILES | CC(=O)OC1(C)C(=O)OC2C3C(C)=CC(=O)C3=C(C)CC(OC(=O)c3ccccc3)C21 |
| InChI | InChI=1S/C24H24O7/c1-12-10-16(26)18-13(2)11-17(29-22(27)15-8-6-5-7-9-15)20-21(19(12)18)30-23(28)24(20,4)31-14(3)25/h5-10,17,19-21H,11H2,1-4H3 |
| InChIKey | AXEYDQJDBPTEEC-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.45 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|