C22H21ClN4O5 — CID 35968556
[2-(2-methyl-3-nitroanilino)-2-oxoethyl] 1-[(2-chlorophenyl)methyl]-3,5-dimethylpyrazole-4-carboxylate (PubChem CID 35968556) has the molecular formula C22H21ClN4O5 and a molecular weight of 456.89 g/mol. Its IUPAC name is [2-(2-methyl-3-nitroanilino)-2-oxoethyl] 1-[(2-chlorophenyl)methyl]-3,5-dimethylpyrazole-4-carboxylate.
| Compound Name | [2-(2-methyl-3-nitroanilino)-2-oxoethyl] 1-[(2-chlorophenyl)methyl]-3,5-dimethylpyrazole-4-carboxylate |
|---|---|
| PubChem CID | 35968556 |
| Molecular Formula | C22H21ClN4O5 |
| Molecular Weight | 456.89 g/mol |
| Exact Mass | 456.12 |
| IUPAC Name | [2-(2-methyl-3-nitroanilino)-2-oxoethyl] 1-[(2-chlorophenyl)methyl]-3,5-dimethylpyrazole-4-carboxylate |
| SMILES | Cc1nn(Cc2ccccc2Cl)c(C)c1C(=O)OCC(=O)Nc1cccc([N+](=O)[O-])c1C |
| InChI | InChI=1S/C22H21ClN4O5/c1-13-18(9-6-10-19(13)27(30)31)24-20(28)12-32-22(29)21-14(2)25-26(15(21)3)11-16-7-4-5-8-17(16)23/h4-10H,11-12H2,1-3H3,(H,24,28) |
| InChIKey | GHDYRIQXCNBDLE-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 116.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.89 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|