About 4-(2-oxopyrrolidin-1-yl)-N'-(2,4,6-trichlorophenyl)benzenesulfonohydrazide
4-(2-oxopyrrolidin-1-yl)-N'-(2,4,6-trichlorophenyl)benzenesulfonohydrazide (PubChem CID 35971691) has the molecular formula C16H14Cl3N3O3S
and a molecular weight of 434.73 g/mol. Its IUPAC name is 4-(2-oxopyrrolidin-1-yl)-N'-(2,4,6-trichlorophenyl)benzenesulfonohydrazide.
Molecular Properties
| Compound Name | 4-(2-oxopyrrolidin-1-yl)-N'-(2,4,6-trichlorophenyl)benzenesulfonohydrazide |
| PubChem CID | 35971691 |
| Molecular Formula | C16H14Cl3N3O3S |
| Molecular Weight | 434.73 g/mol |
| Exact Mass | 432.98 |
| IUPAC Name | 4-(2-oxopyrrolidin-1-yl)-N'-(2,4,6-trichlorophenyl)benzenesulfonohydrazide |
| SMILES | O=C1CCCN1c1ccc(S(=O)(=O)NNc2c(Cl)cc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C16H14Cl3N3O3S/c17-10-8-13(18)16(14(19)9-10)20-21-26(24,25)12-5-3-11(4-6-12)22-7-1-2-15(22)23/h3-6,8-9,20-21H,1-2,7H2 |
| InChIKey | BRLYVWBPLYZINL-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 434.73 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-(2-oxopyrrolidin-1-yl)-N'-(2,4,6-trichlorophenyl)benzenesulfonohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-oxopyrrolidin-1-yl)-N'-(2,4,6-trichlorophenyl)benzenesulfonohydrazide?
The IUPAC name of 4-(2-oxopyrrolidin-1-yl)-N'-(2,4,6-trichlorophenyl)benzenesulfonohydrazide (CID 35971691) is 4-(2-oxopyrrolidin-1-yl)-N'-(2,4,6-trichlorophenyl)benzenesulfonohydrazide.
What is the SMILES notation for 4-(2-oxopyrrolidin-1-yl)-N'-(2,4,6-trichlorophenyl)benzenesulfonohydrazide?
The canonical SMILES for 4-(2-oxopyrrolidin-1-yl)-N'-(2,4,6-trichlorophenyl)benzenesulfonohydrazide is O=C1CCCN1c1ccc(S(=O)(=O)NNc2c(Cl)cc(Cl)cc2Cl)cc1.
What is the InChIKey of 4-(2-oxopyrrolidin-1-yl)-N'-(2,4,6-trichlorophenyl)benzenesulfonohydrazide?
The InChIKey is BRLYVWBPLYZINL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14Cl3N3O3S/c17-10-8-13(18)16(14(19)9-10)20-21-26(24,25)12-5-3-11(4-6-12)22-7-1-2-15(22)23/h3-6,8-9,20-21H,1-2,7H2.
What are the key properties of 4-(2-oxopyrrolidin-1-yl)-N'-(2,4,6-trichlorophenyl)benzenesulfonohydrazide?
4-(2-oxopyrrolidin-1-yl)-N'-(2,4,6-trichlorophenyl)benzenesulfonohydrazide has a molecular weight of 434.73 g/mol, XLogP of 4.08, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-oxopyrrolidin-1-yl)-N'-(2,4,6-trichlorophenyl)benzenesulfonohydrazide is sourced from PubChem (CID 35971691), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).