C16H14Cl3N3O3S — CID 35971691
4-(2-oxopyrrolidin-1-yl)-N'-(2,4,6-trichlorophenyl)benzenesulfonohydrazide (PubChem CID 35971691) has the molecular formula C16H14Cl3N3O3S and a molecular weight of 434.73 g/mol. Its IUPAC name is 4-(2-oxopyrrolidin-1-yl)-N'-(2,4,6-trichlorophenyl)benzenesulfonohydrazide.
| Compound Name | 4-(2-oxopyrrolidin-1-yl)-N'-(2,4,6-trichlorophenyl)benzenesulfonohydrazide |
|---|---|
| PubChem CID | 35971691 |
| Molecular Formula | C16H14Cl3N3O3S |
| Molecular Weight | 434.73 g/mol |
| Exact Mass | 432.98 |
| IUPAC Name | 4-(2-oxopyrrolidin-1-yl)-N'-(2,4,6-trichlorophenyl)benzenesulfonohydrazide |
| SMILES | O=C1CCCN1c1ccc(S(=O)(=O)NNc2c(Cl)cc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C16H14Cl3N3O3S/c17-10-8-13(18)16(14(19)9-10)20-21-26(24,25)12-5-3-11(4-6-12)22-7-1-2-15(22)23/h3-6,8-9,20-21H,1-2,7H2 |
| InChIKey | BRLYVWBPLYZINL-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.73 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|