About 2-chloro-N-(3-cyano-4,5-dimethyl-1H-pyrrol-2-yl)acetamide
2-chloro-N-(3-cyano-4,5-dimethyl-1H-pyrrol-2-yl)acetamide (PubChem CID 3597293) has the molecular formula C9H10ClN3O
and a molecular weight of 211.65 g/mol. Its IUPAC name is 2-chloro-N-(3-cyano-4,5-dimethyl-1H-pyrrol-2-yl)acetamide.
Molecular Properties
| Compound Name | 2-chloro-N-(3-cyano-4,5-dimethyl-1H-pyrrol-2-yl)acetamide |
| PubChem CID | 3597293 |
| Molecular Formula | C9H10ClN3O |
| Molecular Weight | 211.65 g/mol |
| Exact Mass | 211.05 |
| IUPAC Name | 2-chloro-N-(3-cyano-4,5-dimethyl-1H-pyrrol-2-yl)acetamide |
| SMILES | Cc1[nH]c(NC(=O)CCl)c(C#N)c1C |
| InChI | InChI=1S/C9H10ClN3O/c1-5-6(2)12-9(7(5)4-11)13-8(14)3-10/h12H,3H2,1-2H3,(H,13,14) |
| InChIKey | VDFAEFSYUAXJGK-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 68.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.65 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-N-(3-cyano-4,5-dimethyl-1H-pyrrol-2-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-N-(3-cyano-4,5-dimethyl-1H-pyrrol-2-yl)acetamide?
The IUPAC name of 2-chloro-N-(3-cyano-4,5-dimethyl-1H-pyrrol-2-yl)acetamide (CID 3597293) is 2-chloro-N-(3-cyano-4,5-dimethyl-1H-pyrrol-2-yl)acetamide.
What is the SMILES notation for 2-chloro-N-(3-cyano-4,5-dimethyl-1H-pyrrol-2-yl)acetamide?
The canonical SMILES for 2-chloro-N-(3-cyano-4,5-dimethyl-1H-pyrrol-2-yl)acetamide is Cc1[nH]c(NC(=O)CCl)c(C#N)c1C.
What is the InChIKey of 2-chloro-N-(3-cyano-4,5-dimethyl-1H-pyrrol-2-yl)acetamide?
The InChIKey is VDFAEFSYUAXJGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10ClN3O/c1-5-6(2)12-9(7(5)4-11)13-8(14)3-10/h12H,3H2,1-2H3,(H,13,14).
What are the key properties of 2-chloro-N-(3-cyano-4,5-dimethyl-1H-pyrrol-2-yl)acetamide?
2-chloro-N-(3-cyano-4,5-dimethyl-1H-pyrrol-2-yl)acetamide has a molecular weight of 211.65 g/mol, XLogP of 1.68, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-N-(3-cyano-4,5-dimethyl-1H-pyrrol-2-yl)acetamide is sourced from PubChem (CID 3597293), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).