About N-tert-butyltricyclo[4.3.1.13,8]undecane-1-carboxamide
N-tert-butyltricyclo[4.3.1.13,8]undecane-1-carboxamide (PubChem CID 3597650) has the molecular formula C16H27NO
and a molecular weight of 249.40 g/mol. Its IUPAC name is N-tert-butyltricyclo[4.3.1.13,8]undecane-1-carboxamide.
Molecular Properties
| Compound Name | N-tert-butyltricyclo[4.3.1.13,8]undecane-1-carboxamide |
| PubChem CID | 3597650 |
| Molecular Formula | C16H27NO |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.21 |
| IUPAC Name | N-tert-butyltricyclo[4.3.1.13,8]undecane-1-carboxamide |
| SMILES | CC(C)(C)NC(=O)C12CC3CCC(CC(C3)C1)C2 |
| InChI | InChI=1S/C16H27NO/c1-15(2,3)17-14(18)16-8-11-4-5-12(9-16)7-13(6-11)10-16/h11-13H,4-10H2,1-3H3,(H,17,18) |
| InChIKey | GQVAVCMUBAPBDP-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-tert-butyltricyclo[4.3.1.13,8]undecane-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyltricyclo[4.3.1.13,8]undecane-1-carboxamide?
The IUPAC name of N-tert-butyltricyclo[4.3.1.13,8]undecane-1-carboxamide (CID 3597650) is N-tert-butyltricyclo[4.3.1.13,8]undecane-1-carboxamide.
What is the SMILES notation for N-tert-butyltricyclo[4.3.1.13,8]undecane-1-carboxamide?
The canonical SMILES for N-tert-butyltricyclo[4.3.1.13,8]undecane-1-carboxamide is CC(C)(C)NC(=O)C12CC3CCC(CC(C3)C1)C2.
What is the InChIKey of N-tert-butyltricyclo[4.3.1.13,8]undecane-1-carboxamide?
The InChIKey is GQVAVCMUBAPBDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H27NO/c1-15(2,3)17-14(18)16-8-11-4-5-12(9-16)7-13(6-11)10-16/h11-13H,4-10H2,1-3H3,(H,17,18).
What are the key properties of N-tert-butyltricyclo[4.3.1.13,8]undecane-1-carboxamide?
N-tert-butyltricyclo[4.3.1.13,8]undecane-1-carboxamide has a molecular weight of 249.40 g/mol, XLogP of 3.51, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyltricyclo[4.3.1.13,8]undecane-1-carboxamide is sourced from PubChem (CID 3597650), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).