C20H20N4O3S3 — CID 3597654
N'-[2-[(4-oxo-3-prop-2-enyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)sulfanyl]acetyl]thiophene-2-carbohydrazide (PubChem CID 3597654) has the molecular formula C20H20N4O3S3 and a molecular weight of 460.61 g/mol. Its IUPAC name is N'-[2-[(4-oxo-3-prop-2-enyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)sulfanyl]acetyl]thiophene-2-carbohydrazide.
| Compound Name | N'-[2-[(4-oxo-3-prop-2-enyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)sulfanyl]acetyl]thiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 3597654 |
| Molecular Formula | C20H20N4O3S3 |
| Molecular Weight | 460.61 g/mol |
| Exact Mass | 460.07 |
| IUPAC Name | N'-[2-[(4-oxo-3-prop-2-enyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)sulfanyl]acetyl]thiophene-2-carbohydrazide |
| SMILES | C=CCn1c(SCC(=O)NNC(=O)c2cccs2)nc2sc3c(c2c1=O)CCCC3 |
| InChI | InChI=1S/C20H20N4O3S3/c1-2-9-24-19(27)16-12-6-3-4-7-13(12)30-18(16)21-20(24)29-11-15(25)22-23-17(26)14-8-5-10-28-14/h2,5,8,10H,1,3-4,6-7,9,11H2,(H,22,25)(H,23,26) |
| InChIKey | RHQGKICPIRDRDV-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.61 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|