C18H20ClN3O2S — CID 3597841
3-chloro-N-cyclohexyl-N-[2-oxo-2-(1,3-thiazol-2-ylamino)ethyl]benzamide (PubChem CID 3597841) has the molecular formula C18H20ClN3O2S and a molecular weight of 377.90 g/mol. Its IUPAC name is 3-chloro-N-cyclohexyl-N-[2-oxo-2-(1,3-thiazol-2-ylamino)ethyl]benzamide.
| Compound Name | 3-chloro-N-cyclohexyl-N-[2-oxo-2-(1,3-thiazol-2-ylamino)ethyl]benzamide |
|---|---|
| PubChem CID | 3597841 |
| Molecular Formula | C18H20ClN3O2S |
| Molecular Weight | 377.90 g/mol |
| Exact Mass | 377.10 |
| IUPAC Name | 3-chloro-N-cyclohexyl-N-[2-oxo-2-(1,3-thiazol-2-ylamino)ethyl]benzamide |
| SMILES | O=C(CN(C(=O)c1cccc(Cl)c1)C1CCCCC1)Nc1nccs1 |
| InChI | InChI=1S/C18H20ClN3O2S/c19-14-6-4-5-13(11-14)17(24)22(15-7-2-1-3-8-15)12-16(23)21-18-20-9-10-25-18/h4-6,9-11,15H,1-3,7-8,12H2,(H,20,21,23) |
| InChIKey | WUWFVPQOSZYJRS-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.90 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |