C20H23ClN2O4 — CID 3597843
N-[(4-butan-2-yloxy-3-chloro-5-methoxyphenyl)methylideneamino]-4-methoxybenzamide (PubChem CID 3597843) has the molecular formula C20H23ClN2O4 and a molecular weight of 390.87 g/mol. Its IUPAC name is N-[(4-butan-2-yloxy-3-chloro-5-methoxyphenyl)methylideneamino]-4-methoxybenzamide.
| Compound Name | N-[(4-butan-2-yloxy-3-chloro-5-methoxyphenyl)methylideneamino]-4-methoxybenzamide |
|---|---|
| PubChem CID | 3597843 |
| Molecular Formula | C20H23ClN2O4 |
| Molecular Weight | 390.87 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | N-[(4-butan-2-yloxy-3-chloro-5-methoxyphenyl)methylideneamino]-4-methoxybenzamide |
| SMILES | CCC(C)Oc1c(Cl)cc(C=NNC(=O)c2ccc(OC)cc2)cc1OC |
| InChI | InChI=1S/C20H23ClN2O4/c1-5-13(2)27-19-17(21)10-14(11-18(19)26-4)12-22-23-20(24)15-6-8-16(25-3)9-7-15/h6-13H,5H2,1-4H3,(H,23,24) |
| InChIKey | WZVMAOXNQBIWMS-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.87 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|