C44H53F2NO7 — CID 3598158
N-[[17-(3,4-difluorobenzoyl)-5,13-dihydroxy-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-2-(3,4-dimethoxyphenyl)-N-(oxolan-2-ylmethyl)acetamide (PubChem CID 3598158) has the molecular formula C44H53F2NO7 and a molecular weight of 745.90 g/mol. Its IUPAC name is N-[[17-(3,4-difluorobenzoyl)-5,13-dihydroxy-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-2-(3,4-dimethoxyphenyl)-N-(oxolan-2-ylmethyl)acetamide.
| Compound Name | N-[[17-(3,4-difluorobenzoyl)-5,13-dihydroxy-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-2-(3,4-dimethoxyphenyl)-N-(oxolan-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 3598158 |
| Molecular Formula | C44H53F2NO7 |
| Molecular Weight | 745.90 g/mol |
| Exact Mass | 745.38 |
| IUPAC Name | N-[[17-(3,4-difluorobenzoyl)-5,13-dihydroxy-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-2-(3,4-dimethoxyphenyl)-N-(oxolan-2-ylmethyl)acetamide |
| SMILES | COc1ccc(CC(=O)N(CC2CCCO2)CC2(O)CCC3C45C=CC6(C=C4C(=O)c4ccc(F)c(F)c4)CC(O)CCC6(C)C5CCC32C)cc1OC |
| InChI | InChI=1S/C44H53F2NO7/c1-40-14-11-29(48)23-42(40)17-18-44(31(24-42)39(50)28-8-9-32(45)33(46)22-28)36(40)12-15-41(2)37(44)13-16-43(41,51)26-47(25-30-6-5-19-54-30)38(49)21-27-7-10-34(52-3)35(20-27)53-4/h7-10,17-18,20,22,24,29-30,36-37,48,51H,5-6,11-16,19,21,23,25-26H2,1-4H3 |
| InChIKey | XAHQGFPATMDNDZ-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 105.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 745.90 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|