C18H12Cl2O6 — CID 359859
2,5-Bis(4-chlorophenyl)-3,4-dioxohexanedioic acid (PubChem CID 359859) has the molecular formula C18H12Cl2O6 and a molecular weight of 395.20 g/mol. Its IUPAC name is 2,5-bis(4-chlorophenyl)-3,4-dioxohexanedioic acid.
| Compound Name | 2,5-Bis(4-chlorophenyl)-3,4-dioxohexanedioic acid |
|---|---|
| PubChem CID | 359859 |
| Molecular Formula | C18H12Cl2O6 |
| Molecular Weight | 395.20 g/mol |
| Exact Mass | 394.00 |
| IUPAC Name | 2,5-bis(4-chlorophenyl)-3,4-dioxohexanedioic acid |
| SMILES | C1=CC(=CC=C1C(C(=O)C(=O)C(C2=CC=C(C=C2)Cl)C(=O)O)C(=O)O)Cl |
| InChI | InChI=1S/C18H12Cl2O6/c19-11-5-1-9(2-6-11)13(17(23)24)15(21)16(22)14(18(25)26)10-3-7-12(20)8-4-10/h1-8,13-14H,(H,23,24)(H,25,26) |
| InChIKey | ZXNIDWWQGOKFMH-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 109.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | 512 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.20 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|