C14H16F3N5S2 — CID 3598783
5-(5-butylsulfanyl-4-methyl-1,2,4-triazol-3-yl)-1-methyl-3-(trifluoromethyl)thieno[3,2-d]pyrazole (PubChem CID 3598783) has the molecular formula C14H16F3N5S2 and a molecular weight of 375.45 g/mol. Its IUPAC name is 5-(5-butylsulfanyl-4-methyl-1,2,4-triazol-3-yl)-1-methyl-3-(trifluoromethyl)thieno[3,2-d]pyrazole.
| Compound Name | 5-(5-butylsulfanyl-4-methyl-1,2,4-triazol-3-yl)-1-methyl-3-(trifluoromethyl)thieno[3,2-d]pyrazole |
|---|---|
| PubChem CID | 3598783 |
| Molecular Formula | C14H16F3N5S2 |
| Molecular Weight | 375.45 g/mol |
| Exact Mass | 375.08 |
| IUPAC Name | 5-(5-butylsulfanyl-4-methyl-1,2,4-triazol-3-yl)-1-methyl-3-(trifluoromethyl)thieno[3,2-d]pyrazole |
| SMILES | CCCCSc1nnc(-c2cc3c(C(F)(F)F)nn(C)c3s2)n1C |
| InChI | InChI=1S/C14H16F3N5S2/c1-4-5-6-23-13-19-18-11(21(13)2)9-7-8-10(14(15,16)17)20-22(3)12(8)24-9/h7H,4-6H2,1-3H3 |
| InChIKey | RVAPNDUMNSVSIW-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 48.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.45 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|