About 2,5-ditert-butylcyclopenta-1,3-diene
2,5-ditert-butylcyclopenta-1,3-diene (PubChem CID 3599405) has the molecular formula C13H22
and a molecular weight of 178.32 g/mol. Its IUPAC name is 2,5-ditert-butylcyclopenta-1,3-diene.
Molecular Properties
| Compound Name | 2,5-ditert-butylcyclopenta-1,3-diene |
| PubChem CID | 3599405 |
| Molecular Formula | C13H22 |
| Molecular Weight | 178.32 g/mol |
| Exact Mass | 178.17 |
| IUPAC Name | 2,5-ditert-butylcyclopenta-1,3-diene |
| SMILES | CC(C)(C)C1=CC(C(C)(C)C)C=C1 |
| InChI | InChI=1S/C13H22/c1-12(2,3)10-7-8-11(9-10)13(4,5)6/h7-10H,1-6H3 |
| InChIKey | RADVPPBTEASJRZ-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.32 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2,5-ditert-butylcyclopenta-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-ditert-butylcyclopenta-1,3-diene?
The IUPAC name of 2,5-ditert-butylcyclopenta-1,3-diene (CID 3599405) is 2,5-ditert-butylcyclopenta-1,3-diene.
What is the SMILES notation for 2,5-ditert-butylcyclopenta-1,3-diene?
The canonical SMILES for 2,5-ditert-butylcyclopenta-1,3-diene is CC(C)(C)C1=CC(C(C)(C)C)C=C1.
What is the InChIKey of 2,5-ditert-butylcyclopenta-1,3-diene?
The InChIKey is RADVPPBTEASJRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22/c1-12(2,3)10-7-8-11(9-10)13(4,5)6/h7-10H,1-6H3.
What are the key properties of 2,5-ditert-butylcyclopenta-1,3-diene?
2,5-ditert-butylcyclopenta-1,3-diene has a molecular weight of 178.32 g/mol, XLogP of 4.19, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-ditert-butylcyclopenta-1,3-diene is sourced from PubChem (CID 3599405), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).