C15H31N3O3S — CID 3599497
N-[3-(diethylamino)propyl]-1-ethylsulfonylpiperidine-4-carboxamide (PubChem CID 3599497) has the molecular formula C15H31N3O3S and a molecular weight of 333.50 g/mol. Its IUPAC name is N-[3-(diethylamino)propyl]-1-ethylsulfonylpiperidine-4-carboxamide.
| Compound Name | N-[3-(diethylamino)propyl]-1-ethylsulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 3599497 |
| Molecular Formula | C15H31N3O3S |
| Molecular Weight | 333.50 g/mol |
| Exact Mass | 333.21 |
| IUPAC Name | N-[3-(diethylamino)propyl]-1-ethylsulfonylpiperidine-4-carboxamide |
| SMILES | CCN(CC)CCCNC(=O)C1CCN(S(=O)(=O)CC)CC1 |
| InChI | InChI=1S/C15H31N3O3S/c1-4-17(5-2)11-7-10-16-15(19)14-8-12-18(13-9-14)22(20,21)6-3/h14H,4-13H2,1-3H3,(H,16,19) |
| InChIKey | TWVKWFCNDXJVOA-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.50 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|