C23H19Cl2N5O6 — CID 3599771
7-[(2,4-dichlorophenyl)methyl]-8-[2-methoxy-4-(2-nitroethenyl)phenoxy]-1,3-dimethylpurine-2,6-dione (PubChem CID 3599771) has the molecular formula C23H19Cl2N5O6 and a molecular weight of 532.34 g/mol. Its IUPAC name is 7-[(2,4-dichlorophenyl)methyl]-8-[2-methoxy-4-(2-nitroethenyl)phenoxy]-1,3-dimethylpurine-2,6-dione.
| Compound Name | 7-[(2,4-dichlorophenyl)methyl]-8-[2-methoxy-4-(2-nitroethenyl)phenoxy]-1,3-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 3599771 |
| Molecular Formula | C23H19Cl2N5O6 |
| Molecular Weight | 532.34 g/mol |
| Exact Mass | 531.07 |
| IUPAC Name | 7-[(2,4-dichlorophenyl)methyl]-8-[2-methoxy-4-(2-nitroethenyl)phenoxy]-1,3-dimethylpurine-2,6-dione |
| SMILES | COc1cc(C=C[N+](=O)[O-])ccc1Oc1nc2c(c(=O)n(C)c(=O)n2C)n1Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C23H19Cl2N5O6/c1-27-20-19(21(31)28(2)23(27)32)29(12-14-5-6-15(24)11-16(14)25)22(26-20)36-17-7-4-13(8-9-30(33)34)10-18(17)35-3/h4-11H,12H2,1-3H3 |
| InChIKey | HLGIBZSXULYSEM-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 123.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.34 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|