C13H13N5S2 — CID 3600555
[(6-phenyl-2,3-dihydroimidazo[2,1-b][1,3]thiazol-5-yl)methylideneamino]thiourea (PubChem CID 3600555) has the molecular formula C13H13N5S2 and a molecular weight of 303.42 g/mol. Its IUPAC name is [(6-phenyl-2,3-dihydroimidazo[2,1-b][1,3]thiazol-5-yl)methylideneamino]thiourea.
| Compound Name | [(6-phenyl-2,3-dihydroimidazo[2,1-b][1,3]thiazol-5-yl)methylideneamino]thiourea |
|---|---|
| PubChem CID | 3600555 |
| Molecular Formula | C13H13N5S2 |
| Molecular Weight | 303.42 g/mol |
| Exact Mass | 303.06 |
| IUPAC Name | [(6-phenyl-2,3-dihydroimidazo[2,1-b][1,3]thiazol-5-yl)methylideneamino]thiourea |
| SMILES | NC(=S)NN=Cc1c(-c2ccccc2)nc2n1CCS2 |
| InChI | InChI=1S/C13H13N5S2/c14-12(19)17-15-8-10-11(9-4-2-1-3-5-9)16-13-18(10)6-7-20-13/h1-5,8H,6-7H2,(H3,14,17,19) |
| InChIKey | KUAZLPBGTBKEME-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.42 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|