About methyl 6-methyl-4-oxo-3,10-dioxatricyclo[5.2.1.01,5]decane-6-carboxylate
methyl 6-methyl-4-oxo-3,10-dioxatricyclo[5.2.1.01,5]decane-6-carboxylate (PubChem CID 3600596) has the molecular formula C11H14O5
and a molecular weight of 226.23 g/mol. Its IUPAC name is methyl 6-methyl-4-oxo-3,10-dioxatricyclo[5.2.1.01,5]decane-6-carboxylate.
Molecular Properties
| Compound Name | methyl 6-methyl-4-oxo-3,10-dioxatricyclo[5.2.1.01,5]decane-6-carboxylate |
| PubChem CID | 3600596 |
| Molecular Formula | C11H14O5 |
| Molecular Weight | 226.23 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | methyl 6-methyl-4-oxo-3,10-dioxatricyclo[5.2.1.01,5]decane-6-carboxylate |
| SMILES | COC(=O)C1(C)C2CCC3(COC(=O)C31)O2 |
| InChI | InChI=1S/C11H14O5/c1-10(9(13)14-2)6-3-4-11(16-6)5-15-8(12)7(10)11/h6-7H,3-5H2,1-2H3 |
| InChIKey | HVRYQSOBKGUPLN-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.23 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 6-methyl-4-oxo-3,10-dioxatricyclo[5.2.1.01,5]decane-6-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 6-methyl-4-oxo-3,10-dioxatricyclo[5.2.1.01,5]decane-6-carboxylate?
The IUPAC name of methyl 6-methyl-4-oxo-3,10-dioxatricyclo[5.2.1.01,5]decane-6-carboxylate (CID 3600596) is methyl 6-methyl-4-oxo-3,10-dioxatricyclo[5.2.1.01,5]decane-6-carboxylate.
What is the SMILES notation for methyl 6-methyl-4-oxo-3,10-dioxatricyclo[5.2.1.01,5]decane-6-carboxylate?
The canonical SMILES for methyl 6-methyl-4-oxo-3,10-dioxatricyclo[5.2.1.01,5]decane-6-carboxylate is COC(=O)C1(C)C2CCC3(COC(=O)C31)O2.
What is the InChIKey of methyl 6-methyl-4-oxo-3,10-dioxatricyclo[5.2.1.01,5]decane-6-carboxylate?
The InChIKey is HVRYQSOBKGUPLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O5/c1-10(9(13)14-2)6-3-4-11(16-6)5-15-8(12)7(10)11/h6-7H,3-5H2,1-2H3.
What are the key properties of methyl 6-methyl-4-oxo-3,10-dioxatricyclo[5.2.1.01,5]decane-6-carboxylate?
methyl 6-methyl-4-oxo-3,10-dioxatricyclo[5.2.1.01,5]decane-6-carboxylate has a molecular weight of 226.23 g/mol, XLogP of 0.27, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6-methyl-4-oxo-3,10-dioxatricyclo[5.2.1.01,5]decane-6-carboxylate is sourced from PubChem (CID 3600596), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).