4-oxo-3,10-dioxatricyclo[5.2.1.01,5]decane-6-carboxylic acid

C9H10O5 — CID 3600597

IUPAC4-oxo-3,10-dioxatricyclo[5.2.1.01,5]decane-6-carboxylic acid
SMILESO=C(O)C1C2CCC3(COC(=O)C13)O2
InChIInChI=1S/C9H10O5/c10-7(11)5-4-1-2-9(14-4)3-13-8(12)6(5)9/h4-6H,1-3H2,(H,10,11)
InChIKeyZTNJBIVXMUDZMQ-UHFFFAOYSA-N
MW198.17 g/mol
LogP-0.21
Rot. Bonds1

About 4-oxo-3,10-dioxatricyclo[5.2.1.01,5]decane-6-carboxylic acid

4-oxo-3,10-dioxatricyclo[5.2.1.01,5]decane-6-carboxylic acid (PubChem CID 3600597) has the molecular formula C9H10O5 and a molecular weight of 198.17 g/mol. Its IUPAC name is 4-oxo-3,10-dioxatricyclo[5.2.1.01,5]decane-6-carboxylic acid.

Molecular Properties

Compound Name4-oxo-3,10-dioxatricyclo[5.2.1.01,5]decane-6-carboxylic acid
PubChem CID3600597
Molecular FormulaC9H10O5
Molecular Weight198.17 g/mol
Exact Mass198.05
IUPAC Name4-oxo-3,10-dioxatricyclo[5.2.1.01,5]decane-6-carboxylic acid
SMILESO=C(O)C1C2CCC3(COC(=O)C13)O2
InChIInChI=1S/C9H10O5/c10-7(11)5-4-1-2-9(14-4)3-13-8(12)6(5)9/h4-6H,1-3H2,(H,10,11)
InChIKeyZTNJBIVXMUDZMQ-UHFFFAOYSA-N
XLogP-0.21
TPSA72.83 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500198.17
LogP ≤ 5-0.21
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 4-oxo-3,10-dioxatricyclo[5.2.1.01,5]decane-6-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-oxo-3,10-dioxatricyclo[5.2.1.01,5]decane-6-carboxylic acid?
The IUPAC name of 4-oxo-3,10-dioxatricyclo[5.2.1.01,5]decane-6-carboxylic acid (CID 3600597) is 4-oxo-3,10-dioxatricyclo[5.2.1.01,5]decane-6-carboxylic acid.
What is the SMILES notation for 4-oxo-3,10-dioxatricyclo[5.2.1.01,5]decane-6-carboxylic acid?
The canonical SMILES for 4-oxo-3,10-dioxatricyclo[5.2.1.01,5]decane-6-carboxylic acid is O=C(O)C1C2CCC3(COC(=O)C13)O2.
What is the InChIKey of 4-oxo-3,10-dioxatricyclo[5.2.1.01,5]decane-6-carboxylic acid?
The InChIKey is ZTNJBIVXMUDZMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O5/c10-7(11)5-4-1-2-9(14-4)3-13-8(12)6(5)9/h4-6H,1-3H2,(H,10,11).
What are the key properties of 4-oxo-3,10-dioxatricyclo[5.2.1.01,5]decane-6-carboxylic acid?
4-oxo-3,10-dioxatricyclo[5.2.1.01,5]decane-6-carboxylic acid has a molecular weight of 198.17 g/mol, XLogP of -0.21, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-oxo-3,10-dioxatricyclo[5.2.1.01,5]decane-6-carboxylic acid is sourced from PubChem (CID 3600597), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).