About 1-[(2,4-difluorophenyl)-quinolin-3-ylmethyl]piperidine-2-carboxylic acid
1-[(2,4-difluorophenyl)-quinolin-3-ylmethyl]piperidine-2-carboxylic acid (PubChem CID 3600665) has the molecular formula C22H20F2N2O2
and a molecular weight of 382.41 g/mol. Its IUPAC name is 1-[(2,4-difluorophenyl)-quinolin-3-ylmethyl]piperidine-2-carboxylic acid.
Molecular Properties
| Compound Name | 1-[(2,4-difluorophenyl)-quinolin-3-ylmethyl]piperidine-2-carboxylic acid |
| PubChem CID | 3600665 |
| Molecular Formula | C22H20F2N2O2 |
| Molecular Weight | 382.41 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | 1-[(2,4-difluorophenyl)-quinolin-3-ylmethyl]piperidine-2-carboxylic acid |
| SMILES | O=C(O)C1CCCCN1C(c1cnc2ccccc2c1)c1ccc(F)cc1F |
| InChI | InChI=1S/C22H20F2N2O2/c23-16-8-9-17(18(24)12-16)21(26-10-4-3-7-20(26)22(27)28)15-11-14-5-1-2-6-19(14)25-13-15/h1-2,5-6,8-9,11-13,20-21H,3-4,7,10H2,(H,27,28) |
| InChIKey | WXJMZQVDZCQSHC-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.41 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[(2,4-difluorophenyl)-quinolin-3-ylmethyl]piperidine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2,4-difluorophenyl)-quinolin-3-ylmethyl]piperidine-2-carboxylic acid?
The IUPAC name of 1-[(2,4-difluorophenyl)-quinolin-3-ylmethyl]piperidine-2-carboxylic acid (CID 3600665) is 1-[(2,4-difluorophenyl)-quinolin-3-ylmethyl]piperidine-2-carboxylic acid.
What is the SMILES notation for 1-[(2,4-difluorophenyl)-quinolin-3-ylmethyl]piperidine-2-carboxylic acid?
The canonical SMILES for 1-[(2,4-difluorophenyl)-quinolin-3-ylmethyl]piperidine-2-carboxylic acid is O=C(O)C1CCCCN1C(c1cnc2ccccc2c1)c1ccc(F)cc1F.
What is the InChIKey of 1-[(2,4-difluorophenyl)-quinolin-3-ylmethyl]piperidine-2-carboxylic acid?
The InChIKey is WXJMZQVDZCQSHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H20F2N2O2/c23-16-8-9-17(18(24)12-16)21(26-10-4-3-7-20(26)22(27)28)15-11-14-5-1-2-6-19(14)25-13-15/h1-2,5-6,8-9,11-13,20-21H,3-4,7,10H2,(H,27,28).
What are the key properties of 1-[(2,4-difluorophenyl)-quinolin-3-ylmethyl]piperidine-2-carboxylic acid?
1-[(2,4-difluorophenyl)-quinolin-3-ylmethyl]piperidine-2-carboxylic acid has a molecular weight of 382.41 g/mol, XLogP of 4.54, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2,4-difluorophenyl)-quinolin-3-ylmethyl]piperidine-2-carboxylic acid is sourced from PubChem (CID 3600665), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).