About 1,1-dimethyl-3,4-dihydronaphthalen-2-one
1,1-dimethyl-3,4-dihydronaphthalen-2-one (PubChem CID 3601038) has the molecular formula C12H14O
and a molecular weight of 174.24 g/mol. Its IUPAC name is 1,1-dimethyl-3,4-dihydronaphthalen-2-one.
Molecular Properties
| Compound Name | 1,1-dimethyl-3,4-dihydronaphthalen-2-one |
| PubChem CID | 3601038 |
| Molecular Formula | C12H14O |
| Molecular Weight | 174.24 g/mol |
| Exact Mass | 174.10 |
| IUPAC Name | 1,1-dimethyl-3,4-dihydronaphthalen-2-one |
| SMILES | CC1(C)C(=O)CCc2ccccc21 |
| InChI | InChI=1S/C12H14O/c1-12(2)10-6-4-3-5-9(10)7-8-11(12)13/h3-6H,7-8H2,1-2H3 |
| InChIKey | XHMBPLVWLSVQGQ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.24 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1,1-dimethyl-3,4-dihydronaphthalen-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-dimethyl-3,4-dihydronaphthalen-2-one?
The IUPAC name of 1,1-dimethyl-3,4-dihydronaphthalen-2-one (CID 3601038) is 1,1-dimethyl-3,4-dihydronaphthalen-2-one.
What is the SMILES notation for 1,1-dimethyl-3,4-dihydronaphthalen-2-one?
The canonical SMILES for 1,1-dimethyl-3,4-dihydronaphthalen-2-one is CC1(C)C(=O)CCc2ccccc21.
What is the InChIKey of 1,1-dimethyl-3,4-dihydronaphthalen-2-one?
The InChIKey is XHMBPLVWLSVQGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14O/c1-12(2)10-6-4-3-5-9(10)7-8-11(12)13/h3-6H,7-8H2,1-2H3.
What are the key properties of 1,1-dimethyl-3,4-dihydronaphthalen-2-one?
1,1-dimethyl-3,4-dihydronaphthalen-2-one has a molecular weight of 174.24 g/mol, XLogP of 2.48, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-dimethyl-3,4-dihydronaphthalen-2-one is sourced from PubChem (CID 3601038), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).