C45H69NO6 — CID 3601981
(5-methyl-2-propan-2-ylcyclohexyl) N-[[17-(cyclohexanecarbonyl)-5,13-dihydroxy-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-N-(oxolan-2-ylmethyl)carbamate (PubChem CID 3601981) has the molecular formula C45H69NO6 and a molecular weight of 720.05 g/mol. Its IUPAC name is (5-methyl-2-propan-2-ylcyclohexyl) N-[[17-(cyclohexanecarbonyl)-5,13-dihydroxy-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-N-(oxolan-2-ylmethyl)carbamate.
| Compound Name | (5-methyl-2-propan-2-ylcyclohexyl) N-[[17-(cyclohexanecarbonyl)-5,13-dihydroxy-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-N-(oxolan-2-ylmethyl)carbamate |
|---|---|
| PubChem CID | 3601981 |
| Molecular Formula | C45H69NO6 |
| Molecular Weight | 720.05 g/mol |
| Exact Mass | 719.51 |
| IUPAC Name | (5-methyl-2-propan-2-ylcyclohexyl) N-[[17-(cyclohexanecarbonyl)-5,13-dihydroxy-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-N-(oxolan-2-ylmethyl)carbamate |
| SMILES | CC1CCC(C(C)C)C(OC(=O)N(CC2CCCO2)CC2(O)CCC3C45C=CC6(C=C4C(=O)C4CCCCC4)CC(O)CCC6(C)C5CCC32C)C1 |
| InChI | InChI=1S/C45H69NO6/c1-29(2)34-14-13-30(3)24-36(34)52-40(49)46(27-33-12-9-23-51-33)28-44(50)20-17-38-42(44,5)19-16-37-41(4)18-15-32(47)25-43(41)21-22-45(37,38)35(26-43)39(48)31-10-7-6-8-11-31/h21-22,26,29-34,36-38,47,50H,6-20,23-25,27-28H2,1-5H3 |
| InChIKey | BDCXDNQJOXFFRX-UHFFFAOYSA-N |
| XLogP | 8.81 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.05 |
| LogP ≤ 5 | 8.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|