About 5-ethylsulfonyl-1H-1,2,4-triazol-3-amine
5-ethylsulfonyl-1H-1,2,4-triazol-3-amine (PubChem CID 3602166) has the molecular formula C4H8N4O2S
and a molecular weight of 176.20 g/mol. Its IUPAC name is 5-ethylsulfonyl-1H-1,2,4-triazol-3-amine.
Molecular Properties
| Compound Name | 5-ethylsulfonyl-1H-1,2,4-triazol-3-amine |
| PubChem CID | 3602166 |
| Molecular Formula | C4H8N4O2S |
| Molecular Weight | 176.20 g/mol |
| Exact Mass | 176.04 |
| IUPAC Name | 5-ethylsulfonyl-1H-1,2,4-triazol-3-amine |
| SMILES | CCS(=O)(=O)c1nc(N)n[nH]1 |
| InChI | InChI=1S/C4H8N4O2S/c1-2-11(9,10)4-6-3(5)7-8-4/h2H2,1H3,(H3,5,6,7,8) |
| InChIKey | XEQIFQYCESPDQI-UHFFFAOYSA-N |
| XLogP | -0.82 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.20 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-ethylsulfonyl-1H-1,2,4-triazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethylsulfonyl-1H-1,2,4-triazol-3-amine?
The IUPAC name of 5-ethylsulfonyl-1H-1,2,4-triazol-3-amine (CID 3602166) is 5-ethylsulfonyl-1H-1,2,4-triazol-3-amine.
What is the SMILES notation for 5-ethylsulfonyl-1H-1,2,4-triazol-3-amine?
The canonical SMILES for 5-ethylsulfonyl-1H-1,2,4-triazol-3-amine is CCS(=O)(=O)c1nc(N)n[nH]1.
What is the InChIKey of 5-ethylsulfonyl-1H-1,2,4-triazol-3-amine?
The InChIKey is XEQIFQYCESPDQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8N4O2S/c1-2-11(9,10)4-6-3(5)7-8-4/h2H2,1H3,(H3,5,6,7,8).
What are the key properties of 5-ethylsulfonyl-1H-1,2,4-triazol-3-amine?
5-ethylsulfonyl-1H-1,2,4-triazol-3-amine has a molecular weight of 176.20 g/mol, XLogP of -0.82, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethylsulfonyl-1H-1,2,4-triazol-3-amine is sourced from PubChem (CID 3602166), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).