C21H12F3NO2 — CID 3602715
6-[3-(trifluoromethyl)phenyl]-6-azatetracyclo[6.5.2.04,15.011,14]pentadeca-1(14),2,4(15),8,10-pentaene-5,7-dione (PubChem CID 3602715) has the molecular formula C21H12F3NO2 and a molecular weight of 367.33 g/mol. Its IUPAC name is 6-[3-(trifluoromethyl)phenyl]-6-azatetracyclo[6.5.2.04,15.011,14]pentadeca-1(14),2,4(15),8,10-pentaene-5,7-dione.
| Compound Name | 6-[3-(trifluoromethyl)phenyl]-6-azatetracyclo[6.5.2.04,15.011,14]pentadeca-1(14),2,4(15),8,10-pentaene-5,7-dione |
|---|---|
| PubChem CID | 3602715 |
| Molecular Formula | C21H12F3NO2 |
| Molecular Weight | 367.33 g/mol |
| Exact Mass | 367.08 |
| IUPAC Name | 6-[3-(trifluoromethyl)phenyl]-6-azatetracyclo[6.5.2.04,15.011,14]pentadeca-1(14),2,4(15),8,10-pentaene-5,7-dione |
| SMILES | O=C1c2ccc3c4c(ccc(c24)C(=O)N1c1cccc(C(F)(F)F)c1)CC3 |
| InChI | InChI=1S/C21H12F3NO2/c22-21(23,24)13-2-1-3-14(10-13)25-19(26)15-8-6-11-4-5-12-7-9-16(20(25)27)18(15)17(11)12/h1-3,6-10H,4-5H2 |
| InChIKey | DQFGKZWJVPPPHY-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.33 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|