About 9-chloro-5H-thiochromeno[4,3-d]pyrimidin-2-amine
9-chloro-5H-thiochromeno[4,3-d]pyrimidin-2-amine (PubChem CID 3602968) has the molecular formula C11H8ClN3S
and a molecular weight of 249.73 g/mol. Its IUPAC name is 9-chloro-5H-thiochromeno[4,3-d]pyrimidin-2-amine.
Molecular Properties
| Compound Name | 9-chloro-5H-thiochromeno[4,3-d]pyrimidin-2-amine |
| PubChem CID | 3602968 |
| Molecular Formula | C11H8ClN3S |
| Molecular Weight | 249.73 g/mol |
| Exact Mass | 249.01 |
| IUPAC Name | 9-chloro-5H-thiochromeno[4,3-d]pyrimidin-2-amine |
| SMILES | Nc1ncc2c(n1)-c1cc(Cl)ccc1SC2 |
| InChI | InChI=1S/C11H8ClN3S/c12-7-1-2-9-8(3-7)10-6(5-16-9)4-14-11(13)15-10/h1-4H,5H2,(H2,13,14,15) |
| InChIKey | UZJPMIAQMGQZSN-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.73 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 9-chloro-5H-thiochromeno[4,3-d]pyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-chloro-5H-thiochromeno[4,3-d]pyrimidin-2-amine?
The IUPAC name of 9-chloro-5H-thiochromeno[4,3-d]pyrimidin-2-amine (CID 3602968) is 9-chloro-5H-thiochromeno[4,3-d]pyrimidin-2-amine.
What is the SMILES notation for 9-chloro-5H-thiochromeno[4,3-d]pyrimidin-2-amine?
The canonical SMILES for 9-chloro-5H-thiochromeno[4,3-d]pyrimidin-2-amine is Nc1ncc2c(n1)-c1cc(Cl)ccc1SC2.
What is the InChIKey of 9-chloro-5H-thiochromeno[4,3-d]pyrimidin-2-amine?
The InChIKey is UZJPMIAQMGQZSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8ClN3S/c12-7-1-2-9-8(3-7)10-6(5-16-9)4-14-11(13)15-10/h1-4H,5H2,(H2,13,14,15).
What are the key properties of 9-chloro-5H-thiochromeno[4,3-d]pyrimidin-2-amine?
9-chloro-5H-thiochromeno[4,3-d]pyrimidin-2-amine has a molecular weight of 249.73 g/mol, XLogP of 2.98, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 9-chloro-5H-thiochromeno[4,3-d]pyrimidin-2-amine is sourced from PubChem (CID 3602968), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).