C25H26N6O4 — CID 3603688
2-amino-1-[(3-ethoxy-4-hydroxyphenyl)methylideneamino]-N-(oxolan-2-ylmethyl)pyrrolo[3,2-b]quinoxaline-3-carboxamide (PubChem CID 3603688) has the molecular formula C25H26N6O4 and a molecular weight of 474.52 g/mol. Its IUPAC name is 2-amino-1-[(3-ethoxy-4-hydroxyphenyl)methylideneamino]-N-(oxolan-2-ylmethyl)pyrrolo[3,2-b]quinoxaline-3-carboxamide.
| Compound Name | 2-amino-1-[(3-ethoxy-4-hydroxyphenyl)methylideneamino]-N-(oxolan-2-ylmethyl)pyrrolo[3,2-b]quinoxaline-3-carboxamide |
|---|---|
| PubChem CID | 3603688 |
| Molecular Formula | C25H26N6O4 |
| Molecular Weight | 474.52 g/mol |
| Exact Mass | 474.20 |
| IUPAC Name | 2-amino-1-[(3-ethoxy-4-hydroxyphenyl)methylideneamino]-N-(oxolan-2-ylmethyl)pyrrolo[3,2-b]quinoxaline-3-carboxamide |
| SMILES | CCOc1cc(C=Nn2c(N)c(C(=O)NCC3CCCO3)c3nc4ccccc4nc32)ccc1O |
| InChI | InChI=1S/C25H26N6O4/c1-2-34-20-12-15(9-10-19(20)32)13-28-31-23(26)21(25(33)27-14-16-6-5-11-35-16)22-24(31)30-18-8-4-3-7-17(18)29-22/h3-4,7-10,12-13,16,32H,2,5-6,11,14,26H2,1H3,(H,27,33) |
| InChIKey | DHDSBAGQNMPNHX-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 136.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.52 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|