C17H15ClN4O2 — CID 3603733
4-chloro-N'-[2-(1-methylbenzimidazol-2-yl)acetyl]benzohydrazide (PubChem CID 3603733) has the molecular formula C17H15ClN4O2 and a molecular weight of 342.79 g/mol. Its IUPAC name is 4-chloro-N'-[2-(1-methylbenzimidazol-2-yl)acetyl]benzohydrazide.
| Compound Name | 4-chloro-N'-[2-(1-methylbenzimidazol-2-yl)acetyl]benzohydrazide |
|---|---|
| PubChem CID | 3603733 |
| Molecular Formula | C17H15ClN4O2 |
| Molecular Weight | 342.79 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | 4-chloro-N'-[2-(1-methylbenzimidazol-2-yl)acetyl]benzohydrazide |
| SMILES | Cn1c(CC(=O)NNC(=O)c2ccc(Cl)cc2)nc2ccccc21 |
| InChI | InChI=1S/C17H15ClN4O2/c1-22-14-5-3-2-4-13(14)19-15(22)10-16(23)20-21-17(24)11-6-8-12(18)9-7-11/h2-9H,10H2,1H3,(H,20,23)(H,21,24) |
| InChIKey | NTLSIKNBABSWBJ-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.79 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|