C19H23NO2S — CID 3603967
N-cyclopentyl-5-[(3-methylphenyl)methylsulfanylmethyl]furan-2-carboxamide (PubChem CID 3603967) has the molecular formula C19H23NO2S and a molecular weight of 329.46 g/mol. Its IUPAC name is N-cyclopentyl-5-[(3-methylphenyl)methylsulfanylmethyl]furan-2-carboxamide.
| Compound Name | N-cyclopentyl-5-[(3-methylphenyl)methylsulfanylmethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 3603967 |
| Molecular Formula | C19H23NO2S |
| Molecular Weight | 329.46 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | N-cyclopentyl-5-[(3-methylphenyl)methylsulfanylmethyl]furan-2-carboxamide |
| SMILES | Cc1cccc(CSCc2ccc(C(=O)NC3CCCC3)o2)c1 |
| InChI | InChI=1S/C19H23NO2S/c1-14-5-4-6-15(11-14)12-23-13-17-9-10-18(22-17)19(21)20-16-7-2-3-8-16/h4-6,9-11,16H,2-3,7-8,12-13H2,1H3,(H,20,21) |
| InChIKey | NGYSVKVEVYBAGN-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.46 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |