About N-(2-methyl-1,3-dioxoisoindol-4-yl)cyclohexanecarboxamide
N-(2-methyl-1,3-dioxoisoindol-4-yl)cyclohexanecarboxamide (PubChem CID 3604482) has the molecular formula C16H18N2O3
and a molecular weight of 286.33 g/mol. Its IUPAC name is N-(2-methyl-1,3-dioxoisoindol-4-yl)cyclohexanecarboxamide.
Molecular Properties
| Compound Name | N-(2-methyl-1,3-dioxoisoindol-4-yl)cyclohexanecarboxamide |
| PubChem CID | 3604482 |
| Molecular Formula | C16H18N2O3 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | N-(2-methyl-1,3-dioxoisoindol-4-yl)cyclohexanecarboxamide |
| SMILES | CN1C(=O)c2cccc(NC(=O)C3CCCCC3)c2C1=O |
| InChI | InChI=1S/C16H18N2O3/c1-18-15(20)11-8-5-9-12(13(11)16(18)21)17-14(19)10-6-3-2-4-7-10/h5,8-10H,2-4,6-7H2,1H3,(H,17,19) |
| InChIKey | WEOZVLMUNIPPLQ-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze N-(2-methyl-1,3-dioxoisoindol-4-yl)cyclohexanecarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-methyl-1,3-dioxoisoindol-4-yl)cyclohexanecarboxamide?
The IUPAC name of N-(2-methyl-1,3-dioxoisoindol-4-yl)cyclohexanecarboxamide (CID 3604482) is N-(2-methyl-1,3-dioxoisoindol-4-yl)cyclohexanecarboxamide.
What is the SMILES notation for N-(2-methyl-1,3-dioxoisoindol-4-yl)cyclohexanecarboxamide?
The canonical SMILES for N-(2-methyl-1,3-dioxoisoindol-4-yl)cyclohexanecarboxamide is CN1C(=O)c2cccc(NC(=O)C3CCCCC3)c2C1=O.
What is the InChIKey of N-(2-methyl-1,3-dioxoisoindol-4-yl)cyclohexanecarboxamide?
The InChIKey is WEOZVLMUNIPPLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18N2O3/c1-18-15(20)11-8-5-9-12(13(11)16(18)21)17-14(19)10-6-3-2-4-7-10/h5,8-10H,2-4,6-7H2,1H3,(H,17,19).
What are the key properties of N-(2-methyl-1,3-dioxoisoindol-4-yl)cyclohexanecarboxamide?
N-(2-methyl-1,3-dioxoisoindol-4-yl)cyclohexanecarboxamide has a molecular weight of 286.33 g/mol, XLogP of 2.43, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-methyl-1,3-dioxoisoindol-4-yl)cyclohexanecarboxamide is sourced from PubChem (CID 3604482), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).