About 4-(2,5-dimethylthiophen-3-yl)-1,4-dihydropyrimidine
4-(2,5-dimethylthiophen-3-yl)-1,4-dihydropyrimidine (PubChem CID 3604667) has the molecular formula C10H12N2S
and a molecular weight of 192.29 g/mol. Its IUPAC name is 4-(2,5-dimethylthiophen-3-yl)-1,4-dihydropyrimidine.
Molecular Properties
| Compound Name | 4-(2,5-dimethylthiophen-3-yl)-1,4-dihydropyrimidine |
| PubChem CID | 3604667 |
| Molecular Formula | C10H12N2S |
| Molecular Weight | 192.29 g/mol |
| Exact Mass | 192.07 |
| IUPAC Name | 4-(2,5-dimethylthiophen-3-yl)-1,4-dihydropyrimidine |
| SMILES | Cc1cc(C2C=CNC=N2)c(C)s1 |
| InChI | InChI=1S/C10H12N2S/c1-7-5-9(8(2)13-7)10-3-4-11-6-12-10/h3-6,10H,1-2H3,(H,11,12) |
| InChIKey | ONPRQZJDKZHNQE-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.29 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(2,5-dimethylthiophen-3-yl)-1,4-dihydropyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,5-dimethylthiophen-3-yl)-1,4-dihydropyrimidine?
The IUPAC name of 4-(2,5-dimethylthiophen-3-yl)-1,4-dihydropyrimidine (CID 3604667) is 4-(2,5-dimethylthiophen-3-yl)-1,4-dihydropyrimidine.
What is the SMILES notation for 4-(2,5-dimethylthiophen-3-yl)-1,4-dihydropyrimidine?
The canonical SMILES for 4-(2,5-dimethylthiophen-3-yl)-1,4-dihydropyrimidine is Cc1cc(C2C=CNC=N2)c(C)s1.
What is the InChIKey of 4-(2,5-dimethylthiophen-3-yl)-1,4-dihydropyrimidine?
The InChIKey is ONPRQZJDKZHNQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2S/c1-7-5-9(8(2)13-7)10-3-4-11-6-12-10/h3-6,10H,1-2H3,(H,11,12).
What are the key properties of 4-(2,5-dimethylthiophen-3-yl)-1,4-dihydropyrimidine?
4-(2,5-dimethylthiophen-3-yl)-1,4-dihydropyrimidine has a molecular weight of 192.29 g/mol, XLogP of 2.55, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,5-dimethylthiophen-3-yl)-1,4-dihydropyrimidine is sourced from PubChem (CID 3604667), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).