C28H33N3O4S — CID 3605112
4-acetamido-N-[2-(3-ethoxypropylamino)-1-(4-methylphenyl)-2-oxoethyl]-N-(thiophen-2-ylmethyl)benzamide (PubChem CID 3605112) has the molecular formula C28H33N3O4S and a molecular weight of 507.66 g/mol. Its IUPAC name is 4-acetamido-N-[2-(3-ethoxypropylamino)-1-(4-methylphenyl)-2-oxoethyl]-N-(thiophen-2-ylmethyl)benzamide.
| Compound Name | 4-acetamido-N-[2-(3-ethoxypropylamino)-1-(4-methylphenyl)-2-oxoethyl]-N-(thiophen-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 3605112 |
| Molecular Formula | C28H33N3O4S |
| Molecular Weight | 507.66 g/mol |
| Exact Mass | 507.22 |
| IUPAC Name | 4-acetamido-N-[2-(3-ethoxypropylamino)-1-(4-methylphenyl)-2-oxoethyl]-N-(thiophen-2-ylmethyl)benzamide |
| SMILES | CCOCCCNC(=O)C(c1ccc(C)cc1)N(Cc1cccs1)C(=O)c1ccc(NC(C)=O)cc1 |
| InChI | InChI=1S/C28H33N3O4S/c1-4-35-17-6-16-29-27(33)26(22-10-8-20(2)9-11-22)31(19-25-7-5-18-36-25)28(34)23-12-14-24(15-13-23)30-21(3)32/h5,7-15,18,26H,4,6,16-17,19H2,1-3H3,(H,29,33)(H,30,32) |
| InChIKey | ODVMOUQZMBTVKH-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.66 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|