C12H13N2O4- — CID 3605121
1-(6-oxo-1H-pyridine-3-carbonyl)piperidine-4-carboxylate (PubChem CID 3605121) has the molecular formula C12H13N2O4- and a molecular weight of 249.25 g/mol. Its IUPAC name is 1-(6-oxo-1H-pyridine-3-carbonyl)piperidine-4-carboxylate.
| Compound Name | 1-(6-oxo-1H-pyridine-3-carbonyl)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 3605121 |
| Molecular Formula | C12H13N2O4- |
| Molecular Weight | 249.25 g/mol |
| Exact Mass | 249.09 |
| IUPAC Name | 1-(6-oxo-1H-pyridine-3-carbonyl)piperidine-4-carboxylate |
| SMILES | O=C([O-])C1CCN(C(=O)c2ccc(=O)[nH]c2)CC1 |
| InChI | InChI=1S/C12H14N2O4/c15-10-2-1-9(7-13-10)11(16)14-5-3-8(4-6-14)12(17)18/h1-2,7-8H,3-6H2,(H,13,15)(H,17,18)/p-1 |
| InChIKey | IXNULTKZCDKNME-UHFFFAOYSA-M |
| XLogP | -1.02 |
| TPSA | 93.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.25 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |