C17H30N6O2 — CID 3605435
N-(4-methylpentyl)-4,6-dimorpholin-4-yl-1,3,5-triazin-2-amine (PubChem CID 3605435) has the molecular formula C17H30N6O2 and a molecular weight of 350.47 g/mol. Its IUPAC name is N-(4-methylpentyl)-4,6-dimorpholin-4-yl-1,3,5-triazin-2-amine.
| Compound Name | N-(4-methylpentyl)-4,6-dimorpholin-4-yl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 3605435 |
| Molecular Formula | C17H30N6O2 |
| Molecular Weight | 350.47 g/mol |
| Exact Mass | 350.24 |
| IUPAC Name | N-(4-methylpentyl)-4,6-dimorpholin-4-yl-1,3,5-triazin-2-amine |
| SMILES | CC(C)CCCNc1nc(N2CCOCC2)nc(N2CCOCC2)n1 |
| InChI | InChI=1S/C17H30N6O2/c1-14(2)4-3-5-18-15-19-16(22-6-10-24-11-7-22)21-17(20-15)23-8-12-25-13-9-23/h14H,3-13H2,1-2H3,(H,18,19,20,21) |
| InChIKey | BGLBITXVAHEIMO-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 75.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.47 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|