C25H22N4OS — CID 3605680
1-(4,8,10-triphenyl-1-thia-3,4,9,10-tetrazaspiro[4.5]deca-2,8-dien-2-yl)ethanone (PubChem CID 3605680) has the molecular formula C25H22N4OS and a molecular weight of 426.55 g/mol. Its IUPAC name is 1-(4,8,10-triphenyl-1-thia-3,4,9,10-tetrazaspiro[4.5]deca-2,8-dien-2-yl)ethanone.
| Compound Name | 1-(4,8,10-triphenyl-1-thia-3,4,9,10-tetrazaspiro[4.5]deca-2,8-dien-2-yl)ethanone |
|---|---|
| PubChem CID | 3605680 |
| Molecular Formula | C25H22N4OS |
| Molecular Weight | 426.55 g/mol |
| Exact Mass | 426.15 |
| IUPAC Name | 1-(4,8,10-triphenyl-1-thia-3,4,9,10-tetrazaspiro[4.5]deca-2,8-dien-2-yl)ethanone |
| SMILES | CC(=O)C1=NN(c2ccccc2)C2(CCC(c3ccccc3)=NN2c2ccccc2)S1 |
| InChI | InChI=1S/C25H22N4OS/c1-19(30)24-27-29(22-15-9-4-10-16-22)25(31-24)18-17-23(20-11-5-2-6-12-20)26-28(25)21-13-7-3-8-14-21/h2-16H,17-18H2,1H3 |
| InChIKey | DURCXFIKVHWMCD-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 48.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.55 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |