C20H17ClF3N3O3S — CID 3606183
N-[4-chloro-3-(trifluoromethyl)phenyl]-2-(4-methoxyphenyl)imino-3-methyl-4-oxo-1,3-thiazinane-6-carboxamide (PubChem CID 3606183) has the molecular formula C20H17ClF3N3O3S and a molecular weight of 471.89 g/mol. Its IUPAC name is N-[4-chloro-3-(trifluoromethyl)phenyl]-2-(4-methoxyphenyl)imino-3-methyl-4-oxo-1,3-thiazinane-6-carboxamide.
| Compound Name | N-[4-chloro-3-(trifluoromethyl)phenyl]-2-(4-methoxyphenyl)imino-3-methyl-4-oxo-1,3-thiazinane-6-carboxamide |
|---|---|
| PubChem CID | 3606183 |
| Molecular Formula | C20H17ClF3N3O3S |
| Molecular Weight | 471.89 g/mol |
| Exact Mass | 471.06 |
| IUPAC Name | N-[4-chloro-3-(trifluoromethyl)phenyl]-2-(4-methoxyphenyl)imino-3-methyl-4-oxo-1,3-thiazinane-6-carboxamide |
| SMILES | COc1ccc(/N=C2\SC(C(=O)Nc3ccc(Cl)c(C(F)(F)F)c3)CC(=O)N2C)cc1 |
| InChI | InChI=1S/C20H17ClF3N3O3S/c1-27-17(28)10-16(31-19(27)26-11-3-6-13(30-2)7-4-11)18(29)25-12-5-8-15(21)14(9-12)20(22,23)24/h3-9,16H,10H2,1-2H3,(H,25,29)/b26-19- |
| InChIKey | JOSGZLUBNFZOSN-XHPQRKPJSA-N |
| XLogP | 4.96 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.89 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|