About (3-nitrophenyl) furan-2-carboxylate
(3-nitrophenyl) furan-2-carboxylate (PubChem CID 3606661) has the molecular formula C11H7NO5
and a molecular weight of 233.18 g/mol. Its IUPAC name is (3-nitrophenyl) furan-2-carboxylate.
Molecular Properties
| Compound Name | (3-nitrophenyl) furan-2-carboxylate |
| PubChem CID | 3606661 |
| Molecular Formula | C11H7NO5 |
| Molecular Weight | 233.18 g/mol |
| Exact Mass | 233.03 |
| IUPAC Name | (3-nitrophenyl) furan-2-carboxylate |
| SMILES | O=C(Oc1cccc([N+](=O)[O-])c1)c1ccco1 |
| InChI | InChI=1S/C11H7NO5/c13-11(10-5-2-6-16-10)17-9-4-1-3-8(7-9)12(14)15/h1-7H |
| InChIKey | BWQMHXZQLQJRDE-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 82.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.18 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (3-nitrophenyl) furan-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-nitrophenyl) furan-2-carboxylate?
The IUPAC name of (3-nitrophenyl) furan-2-carboxylate (CID 3606661) is (3-nitrophenyl) furan-2-carboxylate.
What is the SMILES notation for (3-nitrophenyl) furan-2-carboxylate?
The canonical SMILES for (3-nitrophenyl) furan-2-carboxylate is O=C(Oc1cccc([N+](=O)[O-])c1)c1ccco1.
What is the InChIKey of (3-nitrophenyl) furan-2-carboxylate?
The InChIKey is BWQMHXZQLQJRDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7NO5/c13-11(10-5-2-6-16-10)17-9-4-1-3-8(7-9)12(14)15/h1-7H.
What are the key properties of (3-nitrophenyl) furan-2-carboxylate?
(3-nitrophenyl) furan-2-carboxylate has a molecular weight of 233.18 g/mol, XLogP of 2.41, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3-nitrophenyl) furan-2-carboxylate is sourced from PubChem (CID 3606661), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).