C22H21N3S — CID 3606847
2,4-dimethyl-N-[1-(10H-phenothiazin-2-yl)ethylideneamino]aniline (PubChem CID 3606847) has the molecular formula C22H21N3S and a molecular weight of 359.50 g/mol. Its IUPAC name is 2,4-dimethyl-N-[1-(10H-phenothiazin-2-yl)ethylideneamino]aniline.
| Compound Name | 2,4-dimethyl-N-[1-(10H-phenothiazin-2-yl)ethylideneamino]aniline |
|---|---|
| PubChem CID | 3606847 |
| Molecular Formula | C22H21N3S |
| Molecular Weight | 359.50 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | 2,4-dimethyl-N-[1-(10H-phenothiazin-2-yl)ethylideneamino]aniline |
| SMILES | CC(=NNc1ccc(C)cc1C)c1ccc2c(c1)Nc1ccccc1S2 |
| InChI | InChI=1S/C22H21N3S/c1-14-8-10-18(15(2)12-14)25-24-16(3)17-9-11-22-20(13-17)23-19-6-4-5-7-21(19)26-22/h4-13,23,25H,1-3H3 |
| InChIKey | SPTAUWCVXMZZLI-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.50 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|