About N,N-dihexylhexanamide
N,N-dihexylhexanamide (PubChem CID 3606987) has the molecular formula C18H37NO
and a molecular weight of 283.50 g/mol. Its IUPAC name is N,N-dihexylhexanamide.
Molecular Properties
| Compound Name | N,N-dihexylhexanamide |
| PubChem CID | 3606987 |
| Molecular Formula | C18H37NO |
| Molecular Weight | 283.50 g/mol |
| Exact Mass | 283.29 |
| IUPAC Name | N,N-dihexylhexanamide |
| SMILES | CCCCCCN(CCCCCC)C(=O)CCCCC |
| InChI | InChI=1S/C18H37NO/c1-4-7-10-13-16-19(17-14-11-8-5-2)18(20)15-12-9-6-3/h4-17H2,1-3H3 |
| InChIKey | PTNKBMIGCUULJJ-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 283.50 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N,N-dihexylhexanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dihexylhexanamide?
The IUPAC name of N,N-dihexylhexanamide (CID 3606987) is N,N-dihexylhexanamide.
What is the SMILES notation for N,N-dihexylhexanamide?
The canonical SMILES for N,N-dihexylhexanamide is CCCCCCN(CCCCCC)C(=O)CCCCC.
What is the InChIKey of N,N-dihexylhexanamide?
The InChIKey is PTNKBMIGCUULJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H37NO/c1-4-7-10-13-16-19(17-14-11-8-5-2)18(20)15-12-9-6-3/h4-17H2,1-3H3.
What are the key properties of N,N-dihexylhexanamide?
N,N-dihexylhexanamide has a molecular weight of 283.50 g/mol, XLogP of 5.56, 14 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dihexylhexanamide is sourced from PubChem (CID 3606987), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).