C19H22N6O3 — CID 3607466
4-(3-imidazol-1-ylpropyliminomethyl)-2-(4-nitrophenyl)-5-propyl-1H-pyrazol-3-one (PubChem CID 3607466) has the molecular formula C19H22N6O3 and a molecular weight of 382.42 g/mol. Its IUPAC name is 4-(3-imidazol-1-ylpropyliminomethyl)-2-(4-nitrophenyl)-5-propyl-1H-pyrazol-3-one.
| Compound Name | 4-(3-imidazol-1-ylpropyliminomethyl)-2-(4-nitrophenyl)-5-propyl-1H-pyrazol-3-one |
|---|---|
| PubChem CID | 3607466 |
| Molecular Formula | C19H22N6O3 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | 4-(3-imidazol-1-ylpropyliminomethyl)-2-(4-nitrophenyl)-5-propyl-1H-pyrazol-3-one |
| SMILES | CCCc1[nH]n(-c2ccc([N+](=O)[O-])cc2)c(=O)c1/C=N/CCCn1ccnc1 |
| InChI | InChI=1S/C19H22N6O3/c1-2-4-18-17(13-20-9-3-11-23-12-10-21-14-23)19(26)24(22-18)15-5-7-16(8-6-15)25(27)28/h5-8,10,12-14,22H,2-4,9,11H2,1H3/b20-13+ |
| InChIKey | XPBFJGBHYCRICO-DEDYPNTBSA-N |
| XLogP | 2.73 |
| TPSA | 111.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|