C22H23BrN2O4S — CID 3608004
[2-[(3-cyano-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-2-oxoethyl] 4-(3-bromophenoxy)butanoate (PubChem CID 3608004) has the molecular formula C22H23BrN2O4S and a molecular weight of 491.41 g/mol. Its IUPAC name is [2-[(3-cyano-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-2-oxoethyl] 4-(3-bromophenoxy)butanoate.
| Compound Name | [2-[(3-cyano-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-2-oxoethyl] 4-(3-bromophenoxy)butanoate |
|---|---|
| PubChem CID | 3608004 |
| Molecular Formula | C22H23BrN2O4S |
| Molecular Weight | 491.41 g/mol |
| Exact Mass | 490.06 |
| IUPAC Name | [2-[(3-cyano-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-2-oxoethyl] 4-(3-bromophenoxy)butanoate |
| SMILES | CC1CCc2c(sc(NC(=O)COC(=O)CCCOc3cccc(Br)c3)c2C#N)C1 |
| InChI | InChI=1S/C22H23BrN2O4S/c1-14-7-8-17-18(12-24)22(30-19(17)10-14)25-20(26)13-29-21(27)6-3-9-28-16-5-2-4-15(23)11-16/h2,4-5,11,14H,3,6-10,13H2,1H3,(H,25,26) |
| InChIKey | XPRGGWHMGOVIAP-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.41 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|