C29H26N2O4 — CID 3608244
ethyl 1-[3-[(3-acetylphenyl)carbamoyl]phenyl]-2-methyl-5-phenylpyrrole-3-carboxylate (PubChem CID 3608244) has the molecular formula C29H26N2O4 and a molecular weight of 466.54 g/mol. Its IUPAC name is ethyl 1-[3-[(3-acetylphenyl)carbamoyl]phenyl]-2-methyl-5-phenylpyrrole-3-carboxylate.
| Compound Name | ethyl 1-[3-[(3-acetylphenyl)carbamoyl]phenyl]-2-methyl-5-phenylpyrrole-3-carboxylate |
|---|---|
| PubChem CID | 3608244 |
| Molecular Formula | C29H26N2O4 |
| Molecular Weight | 466.54 g/mol |
| Exact Mass | 466.19 |
| IUPAC Name | ethyl 1-[3-[(3-acetylphenyl)carbamoyl]phenyl]-2-methyl-5-phenylpyrrole-3-carboxylate |
| SMILES | CCOC(=O)c1cc(-c2ccccc2)n(-c2cccc(C(=O)Nc3cccc(C(C)=O)c3)c2)c1C |
| InChI | InChI=1S/C29H26N2O4/c1-4-35-29(34)26-18-27(21-10-6-5-7-11-21)31(19(26)2)25-15-9-13-23(17-25)28(33)30-24-14-8-12-22(16-24)20(3)32/h5-18H,4H2,1-3H3,(H,30,33) |
| InChIKey | YENOFMGLMYURMK-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.54 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|