About 8b-methyl-4-phenyl-2,3a-dihydro-1H-furo[2,3-b]indole
8b-methyl-4-phenyl-2,3a-dihydro-1H-furo[2,3-b]indole (PubChem CID 3608760) has the molecular formula C17H17NO
and a molecular weight of 251.33 g/mol. Its IUPAC name is 8b-methyl-4-phenyl-2,3a-dihydro-1H-furo[2,3-b]indole.
Molecular Properties
| Compound Name | 8b-methyl-4-phenyl-2,3a-dihydro-1H-furo[2,3-b]indole |
| PubChem CID | 3608760 |
| Molecular Formula | C17H17NO |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | 8b-methyl-4-phenyl-2,3a-dihydro-1H-furo[2,3-b]indole |
| SMILES | CC12CCOC1N(c1ccccc1)c1ccccc12 |
| InChI | InChI=1S/C17H17NO/c1-17-11-12-19-16(17)18(13-7-3-2-4-8-13)15-10-6-5-9-14(15)17/h2-10,16H,11-12H2,1H3 |
| InChIKey | LYEMDWOVMXRHTL-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 8b-methyl-4-phenyl-2,3a-dihydro-1H-furo[2,3-b]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8b-methyl-4-phenyl-2,3a-dihydro-1H-furo[2,3-b]indole?
The IUPAC name of 8b-methyl-4-phenyl-2,3a-dihydro-1H-furo[2,3-b]indole (CID 3608760) is 8b-methyl-4-phenyl-2,3a-dihydro-1H-furo[2,3-b]indole.
What is the SMILES notation for 8b-methyl-4-phenyl-2,3a-dihydro-1H-furo[2,3-b]indole?
The canonical SMILES for 8b-methyl-4-phenyl-2,3a-dihydro-1H-furo[2,3-b]indole is CC12CCOC1N(c1ccccc1)c1ccccc12.
What is the InChIKey of 8b-methyl-4-phenyl-2,3a-dihydro-1H-furo[2,3-b]indole?
The InChIKey is LYEMDWOVMXRHTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17NO/c1-17-11-12-19-16(17)18(13-7-3-2-4-8-13)15-10-6-5-9-14(15)17/h2-10,16H,11-12H2,1H3.
What are the key properties of 8b-methyl-4-phenyl-2,3a-dihydro-1H-furo[2,3-b]indole?
8b-methyl-4-phenyl-2,3a-dihydro-1H-furo[2,3-b]indole has a molecular weight of 251.33 g/mol, XLogP of 3.84, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8b-methyl-4-phenyl-2,3a-dihydro-1H-furo[2,3-b]indole is sourced from PubChem (CID 3608760), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).