C30H22N2O2S — CID 3609315
1-(4-methylphenyl)-4,10a-diphenyl-5H-pyrrolo[2,3-b][1,5]benzothiazepine-2,3-dione (PubChem CID 3609315) has the molecular formula C30H22N2O2S and a molecular weight of 474.59 g/mol. Its IUPAC name is 1-(4-methylphenyl)-4,10a-diphenyl-5H-pyrrolo[2,3-b][1,5]benzothiazepine-2,3-dione.
| Compound Name | 1-(4-methylphenyl)-4,10a-diphenyl-5H-pyrrolo[2,3-b][1,5]benzothiazepine-2,3-dione |
|---|---|
| PubChem CID | 3609315 |
| Molecular Formula | C30H22N2O2S |
| Molecular Weight | 474.59 g/mol |
| Exact Mass | 474.14 |
| IUPAC Name | 1-(4-methylphenyl)-4,10a-diphenyl-5H-pyrrolo[2,3-b][1,5]benzothiazepine-2,3-dione |
| SMILES | Cc1ccc(N2C(=O)C(=O)C3=C(c4ccccc4)Nc4ccccc4SC32c2ccccc2)cc1 |
| InChI | InChI=1S/C30H22N2O2S/c1-20-16-18-23(19-17-20)32-29(34)28(33)26-27(21-10-4-2-5-11-21)31-24-14-8-9-15-25(24)35-30(26,32)22-12-6-3-7-13-22/h2-19,31H,1H3 |
| InChIKey | BIYMQHDYSXKKFC-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.59 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|