C23H22N4O6 — CID 3609478
3-(4-nitrophenyl)-1-[4-[3-(4-nitrophenyl)prop-2-enoyl]-1,4-diazepan-1-yl]prop-2-en-1-one (PubChem CID 3609478) has the molecular formula C23H22N4O6 and a molecular weight of 450.45 g/mol. Its IUPAC name is 3-(4-nitrophenyl)-1-[4-[3-(4-nitrophenyl)prop-2-enoyl]-1,4-diazepan-1-yl]prop-2-en-1-one.
| Compound Name | 3-(4-nitrophenyl)-1-[4-[3-(4-nitrophenyl)prop-2-enoyl]-1,4-diazepan-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 3609478 |
| Molecular Formula | C23H22N4O6 |
| Molecular Weight | 450.45 g/mol |
| Exact Mass | 450.15 |
| IUPAC Name | 3-(4-nitrophenyl)-1-[4-[3-(4-nitrophenyl)prop-2-enoyl]-1,4-diazepan-1-yl]prop-2-en-1-one |
| SMILES | O=C(C=Cc1ccc([N+](=O)[O-])cc1)N1CCCN(C(=O)C=Cc2ccc([N+](=O)[O-])cc2)CC1 |
| InChI | InChI=1S/C23H22N4O6/c28-22(12-6-18-2-8-20(9-3-18)26(30)31)24-14-1-15-25(17-16-24)23(29)13-7-19-4-10-21(11-5-19)27(32)33/h2-13H,1,14-17H2 |
| InChIKey | BRSLPYPKFYKKPG-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 126.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.45 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|