About (1-ethyl-2-oxobenzo[cd]indol-6-yl)sulfonyl-(4-methyl-1,3-thiazol-2-yl)azanide
(1-ethyl-2-oxobenzo[cd]indol-6-yl)sulfonyl-(4-methyl-1,3-thiazol-2-yl)azanide (PubChem CID 3609602) has the molecular formula C17H14N3O3S2-
and a molecular weight of 372.45 g/mol. Its IUPAC name is (1-ethyl-2-oxobenzo[cd]indol-6-yl)sulfonyl-(4-methyl-1,3-thiazol-2-yl)azanide.
Molecular Properties
| Compound Name | (1-ethyl-2-oxobenzo[cd]indol-6-yl)sulfonyl-(4-methyl-1,3-thiazol-2-yl)azanide |
| PubChem CID | 3609602 |
| Molecular Formula | C17H14N3O3S2- |
| Molecular Weight | 372.45 g/mol |
| Exact Mass | 372.05 |
| IUPAC Name | (1-ethyl-2-oxobenzo[cd]indol-6-yl)sulfonyl-(4-methyl-1,3-thiazol-2-yl)azanide |
| SMILES | CCN1C(=O)c2cccc3c(S(=O)(=O)[N-]c4nc(C)cs4)ccc1c23 |
| InChI | InChI=1S/C17H14N3O3S2/c1-3-20-13-7-8-14(11-5-4-6-12(15(11)13)16(20)21)25(22,23)19-17-18-10(2)9-24-17/h4-9H,3H2,1-2H3/q-1 |
| InChIKey | HZNIEUVMFVUASV-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 81.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.45 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (1-ethyl-2-oxobenzo[cd]indol-6-yl)sulfonyl-(4-methyl-1,3-thiazol-2-yl)azanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-ethyl-2-oxobenzo[cd]indol-6-yl)sulfonyl-(4-methyl-1,3-thiazol-2-yl)azanide?
The IUPAC name of (1-ethyl-2-oxobenzo[cd]indol-6-yl)sulfonyl-(4-methyl-1,3-thiazol-2-yl)azanide (CID 3609602) is (1-ethyl-2-oxobenzo[cd]indol-6-yl)sulfonyl-(4-methyl-1,3-thiazol-2-yl)azanide.
What is the SMILES notation for (1-ethyl-2-oxobenzo[cd]indol-6-yl)sulfonyl-(4-methyl-1,3-thiazol-2-yl)azanide?
The canonical SMILES for (1-ethyl-2-oxobenzo[cd]indol-6-yl)sulfonyl-(4-methyl-1,3-thiazol-2-yl)azanide is CCN1C(=O)c2cccc3c(S(=O)(=O)[N-]c4nc(C)cs4)ccc1c23.
What is the InChIKey of (1-ethyl-2-oxobenzo[cd]indol-6-yl)sulfonyl-(4-methyl-1,3-thiazol-2-yl)azanide?
The InChIKey is HZNIEUVMFVUASV-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14N3O3S2/c1-3-20-13-7-8-14(11-5-4-6-12(15(11)13)16(20)21)25(22,23)19-17-18-10(2)9-24-17/h4-9H,3H2,1-2H3/q-1.
What are the key properties of (1-ethyl-2-oxobenzo[cd]indol-6-yl)sulfonyl-(4-methyl-1,3-thiazol-2-yl)azanide?
(1-ethyl-2-oxobenzo[cd]indol-6-yl)sulfonyl-(4-methyl-1,3-thiazol-2-yl)azanide has a molecular weight of 372.45 g/mol, XLogP of 3.98, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (1-ethyl-2-oxobenzo[cd]indol-6-yl)sulfonyl-(4-methyl-1,3-thiazol-2-yl)azanide is sourced from PubChem (CID 3609602), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).