C14H16N2OS — CID 3610131
2-(4-ethylphenyl)-3-sulfanylidene-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazol-1-one (PubChem CID 3610131) has the molecular formula C14H16N2OS and a molecular weight of 260.36 g/mol. Its IUPAC name is 2-(4-ethylphenyl)-3-sulfanylidene-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazol-1-one.
| Compound Name | 2-(4-ethylphenyl)-3-sulfanylidene-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazol-1-one |
|---|---|
| PubChem CID | 3610131 |
| Molecular Formula | C14H16N2OS |
| Molecular Weight | 260.36 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | 2-(4-ethylphenyl)-3-sulfanylidene-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazol-1-one |
| SMILES | CCc1ccc(N2C(=O)C3CCCN3C2=S)cc1 |
| InChI | InChI=1S/C14H16N2OS/c1-2-10-5-7-11(8-6-10)16-13(17)12-4-3-9-15(12)14(16)18/h5-8,12H,2-4,9H2,1H3 |
| InChIKey | JXWUQWIMWCWJCK-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.36 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|