About 1-(4,6-dimethoxypyrimidin-2-yl)-3-(4-fluorophenyl)sulfonylurea
1-(4,6-dimethoxypyrimidin-2-yl)-3-(4-fluorophenyl)sulfonylurea (PubChem CID 3610454) has the molecular formula C13H13FN4O5S
and a molecular weight of 356.34 g/mol. Its IUPAC name is 1-(4,6-dimethoxypyrimidin-2-yl)-3-(4-fluorophenyl)sulfonylurea.
Molecular Properties
| Compound Name | 1-(4,6-dimethoxypyrimidin-2-yl)-3-(4-fluorophenyl)sulfonylurea |
| PubChem CID | 3610454 |
| Molecular Formula | C13H13FN4O5S |
| Molecular Weight | 356.34 g/mol |
| Exact Mass | 356.06 |
| IUPAC Name | 1-(4,6-dimethoxypyrimidin-2-yl)-3-(4-fluorophenyl)sulfonylurea |
| SMILES | COc1cc(OC)nc(NC(=O)NS(=O)(=O)c2ccc(F)cc2)n1 |
| InChI | InChI=1S/C13H13FN4O5S/c1-22-10-7-11(23-2)16-12(15-10)17-13(19)18-24(20,21)9-5-3-8(14)4-6-9/h3-7H,1-2H3,(H2,15,16,17,18,19) |
| InChIKey | VAQOGEFIAXRZGC-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 119.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.34 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 1-(4,6-dimethoxypyrimidin-2-yl)-3-(4-fluorophenyl)sulfonylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4,6-dimethoxypyrimidin-2-yl)-3-(4-fluorophenyl)sulfonylurea?
The IUPAC name of 1-(4,6-dimethoxypyrimidin-2-yl)-3-(4-fluorophenyl)sulfonylurea (CID 3610454) is 1-(4,6-dimethoxypyrimidin-2-yl)-3-(4-fluorophenyl)sulfonylurea.
What is the SMILES notation for 1-(4,6-dimethoxypyrimidin-2-yl)-3-(4-fluorophenyl)sulfonylurea?
The canonical SMILES for 1-(4,6-dimethoxypyrimidin-2-yl)-3-(4-fluorophenyl)sulfonylurea is COc1cc(OC)nc(NC(=O)NS(=O)(=O)c2ccc(F)cc2)n1.
What is the InChIKey of 1-(4,6-dimethoxypyrimidin-2-yl)-3-(4-fluorophenyl)sulfonylurea?
The InChIKey is VAQOGEFIAXRZGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13FN4O5S/c1-22-10-7-11(23-2)16-12(15-10)17-13(19)18-24(20,21)9-5-3-8(14)4-6-9/h3-7H,1-2H3,(H2,15,16,17,18,19).
What are the key properties of 1-(4,6-dimethoxypyrimidin-2-yl)-3-(4-fluorophenyl)sulfonylurea?
1-(4,6-dimethoxypyrimidin-2-yl)-3-(4-fluorophenyl)sulfonylurea has a molecular weight of 356.34 g/mol, XLogP of 1.14, 5 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4,6-dimethoxypyrimidin-2-yl)-3-(4-fluorophenyl)sulfonylurea is sourced from PubChem (CID 3610454), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).