About 2-[[3-(2,2-dimethyloxan-4-yl)-3-(2-methoxyphenyl)propyl]iminomethyl]phenol
2-[[3-(2,2-dimethyloxan-4-yl)-3-(2-methoxyphenyl)propyl]iminomethyl]phenol (PubChem CID 3610492) has the molecular formula C24H31NO3
and a molecular weight of 381.52 g/mol. Its IUPAC name is 2-[[3-(2,2-dimethyloxan-4-yl)-3-(2-methoxyphenyl)propyl]iminomethyl]phenol.
Molecular Properties
| Compound Name | 2-[[3-(2,2-dimethyloxan-4-yl)-3-(2-methoxyphenyl)propyl]iminomethyl]phenol |
| PubChem CID | 3610492 |
| Molecular Formula | C24H31NO3 |
| Molecular Weight | 381.52 g/mol |
| Exact Mass | 381.23 |
| IUPAC Name | 2-[[3-(2,2-dimethyloxan-4-yl)-3-(2-methoxyphenyl)propyl]iminomethyl]phenol |
| SMILES | COc1ccccc1C(CC/N=C/c1ccccc1O)C1CCOC(C)(C)C1 |
| InChI | InChI=1S/C24H31NO3/c1-24(2)16-18(13-15-28-24)20(21-9-5-7-11-23(21)27-3)12-14-25-17-19-8-4-6-10-22(19)26/h4-11,17-18,20,26H,12-16H2,1-3H3/b25-17+ |
| InChIKey | RFBQGXKIZQGLDS-KOEQRZSOSA-N |
| XLogP | 5.20 |
| TPSA | 51.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 381.52 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[[3-(2,2-dimethyloxan-4-yl)-3-(2-methoxyphenyl)propyl]iminomethyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[3-(2,2-dimethyloxan-4-yl)-3-(2-methoxyphenyl)propyl]iminomethyl]phenol?
The IUPAC name of 2-[[3-(2,2-dimethyloxan-4-yl)-3-(2-methoxyphenyl)propyl]iminomethyl]phenol (CID 3610492) is 2-[[3-(2,2-dimethyloxan-4-yl)-3-(2-methoxyphenyl)propyl]iminomethyl]phenol.
What is the SMILES notation for 2-[[3-(2,2-dimethyloxan-4-yl)-3-(2-methoxyphenyl)propyl]iminomethyl]phenol?
The canonical SMILES for 2-[[3-(2,2-dimethyloxan-4-yl)-3-(2-methoxyphenyl)propyl]iminomethyl]phenol is COc1ccccc1C(CC/N=C/c1ccccc1O)C1CCOC(C)(C)C1.
What is the InChIKey of 2-[[3-(2,2-dimethyloxan-4-yl)-3-(2-methoxyphenyl)propyl]iminomethyl]phenol?
The InChIKey is RFBQGXKIZQGLDS-KOEQRZSOSA-N. The full InChI is InChI=1S/C24H31NO3/c1-24(2)16-18(13-15-28-24)20(21-9-5-7-11-23(21)27-3)12-14-25-17-19-8-4-6-10-22(19)26/h4-11,17-18,20,26H,12-16H2,1-3H3/b25-17+.
What are the key properties of 2-[[3-(2,2-dimethyloxan-4-yl)-3-(2-methoxyphenyl)propyl]iminomethyl]phenol?
2-[[3-(2,2-dimethyloxan-4-yl)-3-(2-methoxyphenyl)propyl]iminomethyl]phenol has a molecular weight of 381.52 g/mol, XLogP of 5.20, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[3-(2,2-dimethyloxan-4-yl)-3-(2-methoxyphenyl)propyl]iminomethyl]phenol is sourced from PubChem (CID 3610492), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).