About N-[[1-(2,4-dichlorophenyl)pyrrol-2-yl]methyl]adamantan-1-amine
N-[[1-(2,4-dichlorophenyl)pyrrol-2-yl]methyl]adamantan-1-amine (PubChem CID 3611095) has the molecular formula C21H24Cl2N2
and a molecular weight of 375.34 g/mol. Its IUPAC name is N-[[1-(2,4-dichlorophenyl)pyrrol-2-yl]methyl]adamantan-1-amine.
Molecular Properties
| Compound Name | N-[[1-(2,4-dichlorophenyl)pyrrol-2-yl]methyl]adamantan-1-amine |
| PubChem CID | 3611095 |
| Molecular Formula | C21H24Cl2N2 |
| Molecular Weight | 375.34 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | N-[[1-(2,4-dichlorophenyl)pyrrol-2-yl]methyl]adamantan-1-amine |
| SMILES | Clc1ccc(-n2cccc2CNC23CC4CC(CC(C4)C2)C3)c(Cl)c1 |
| InChI | InChI=1S/C21H24Cl2N2/c22-17-3-4-20(19(23)9-17)25-5-1-2-18(25)13-24-21-10-14-6-15(11-21)8-16(7-14)12-21/h1-5,9,14-16,24H,6-8,10-13H2 |
| InChIKey | NHZWVLOXTPHLJK-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 375.34 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[[1-(2,4-dichlorophenyl)pyrrol-2-yl]methyl]adamantan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[1-(2,4-dichlorophenyl)pyrrol-2-yl]methyl]adamantan-1-amine?
The IUPAC name of N-[[1-(2,4-dichlorophenyl)pyrrol-2-yl]methyl]adamantan-1-amine (CID 3611095) is N-[[1-(2,4-dichlorophenyl)pyrrol-2-yl]methyl]adamantan-1-amine.
What is the SMILES notation for N-[[1-(2,4-dichlorophenyl)pyrrol-2-yl]methyl]adamantan-1-amine?
The canonical SMILES for N-[[1-(2,4-dichlorophenyl)pyrrol-2-yl]methyl]adamantan-1-amine is Clc1ccc(-n2cccc2CNC23CC4CC(CC(C4)C2)C3)c(Cl)c1.
What is the InChIKey of N-[[1-(2,4-dichlorophenyl)pyrrol-2-yl]methyl]adamantan-1-amine?
The InChIKey is NHZWVLOXTPHLJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H24Cl2N2/c22-17-3-4-20(19(23)9-17)25-5-1-2-18(25)13-24-21-10-14-6-15(11-21)8-16(7-14)12-21/h1-5,9,14-16,24H,6-8,10-13H2.
What are the key properties of N-[[1-(2,4-dichlorophenyl)pyrrol-2-yl]methyl]adamantan-1-amine?
N-[[1-(2,4-dichlorophenyl)pyrrol-2-yl]methyl]adamantan-1-amine has a molecular weight of 375.34 g/mol, XLogP of 5.84, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[1-(2,4-dichlorophenyl)pyrrol-2-yl]methyl]adamantan-1-amine is sourced from PubChem (CID 3611095), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).